About 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide
6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide (PubChem CID 118313500) has the molecular formula C10H8N4O5
and a molecular weight of 264.20 g/mol. Its IUPAC name is 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide |
| PubChem CID | 118313500 |
| Molecular Formula | C10H8N4O5 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1cc[nH]c(=O)c1)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H8N4O5/c15-5-3-4(1-2-11-5)12-7(16)6-8(17)13-10(19)14-9(6)18/h1-3H,(H2,11,12,15,16)(H3,13,14,17,18,19) |
| InChIKey | BGAMWQONHBVEDS-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 147.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide?
The IUPAC name of 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide (CID 118313500) is 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide?
The canonical SMILES for 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide is O=C(Nc1cc[nH]c(=O)c1)c1c(O)[nH]c(=O)[nH]c1=O.
What is the InChIKey of 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide?
The InChIKey is BGAMWQONHBVEDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O5/c15-5-3-4(1-2-11-5)12-7(16)6-8(17)13-10(19)14-9(6)18/h1-3H,(H2,11,12,15,16)(H3,13,14,17,18,19).
What are the key properties of 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide?
6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide has a molecular weight of 264.20 g/mol, XLogP of -1.29, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,4-dioxo-N-(2-oxo-1H-pyridin-4-yl)-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 118313500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).