C11H9N5O4 — CID 145126705
N-(3,4-diiminocyclohexa-1,5-dien-1-yl)-6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 145126705) has the molecular formula C11H9N5O4 and a molecular weight of 275.22 g/mol. Its IUPAC name is N-(3,4-diiminocyclohexa-1,5-dien-1-yl)-6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(3,4-diiminocyclohexa-1,5-dien-1-yl)-6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 145126705 |
| Molecular Formula | C11H9N5O4 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-(3,4-diiminocyclohexa-1,5-dien-1-yl)-6-hydroxy-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | [H]/N=C1\C=CC(NC(=O)c2c(O)[nH]c(=O)[nH]c2=O)=C\C1=N/[H] |
| InChI | InChI=1S/C11H9N5O4/c12-5-2-1-4(3-6(5)13)14-8(17)7-9(18)15-11(20)16-10(7)19/h1-3,12-13H,(H,14,17)(H3,15,16,18,19,20)/b12-5+,13-6+ |
| InChIKey | KJBUIXYKYVAQKP-BYDSPXIWSA-N |
| XLogP | -1.01 |
| TPSA | 162.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|