C6H8N4O3 — CID 154186624
5-ethanehydrazonoyl-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 154186624) has the molecular formula C6H8N4O3 and a molecular weight of 184.16 g/mol. Its IUPAC name is 5-ethanehydrazonoyl-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-ethanehydrazonoyl-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154186624 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 5-ethanehydrazonoyl-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | CC(=NN)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H8N4O3/c1-2(10-7)3-4(11)8-6(13)9-5(3)12/h7H2,1H3,(H3,8,9,11,12,13) |
| InChIKey | DLDVXIKFSILPFE-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|