C8H12N6O3 — CID 135559000
2-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)propylideneamino]guanidine (PubChem CID 135559000) has the molecular formula C8H12N6O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)propylideneamino]guanidine.
| Compound Name | 2-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)propylideneamino]guanidine |
|---|---|
| PubChem CID | 135559000 |
| Molecular Formula | C8H12N6O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)propylideneamino]guanidine |
| SMILES | CC/C(=N\N=C(N)N)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H12N6O3/c1-2-3(13-14-7(9)10)4-5(15)11-8(17)12-6(4)16/h2H2,1H3,(H4,9,10,14)(H3,11,12,15,16,17)/b13-3+ |
| InChIKey | WTPFLTNLMIQSED-QLKAYGNNSA-N |
| XLogP | -1.84 |
| TPSA | 162.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|