C7H10N6O3 — CID 135625814
2-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]guanidine (PubChem CID 135625814) has the molecular formula C7H10N6O3 and a molecular weight of 226.20 g/mol. Its IUPAC name is 2-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]guanidine.
| Compound Name | 2-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 135625814 |
| Molecular Formula | C7H10N6O3 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H10N6O3/c1-2(12-13-6(8)9)3-4(14)10-7(16)11-5(3)15/h1H3,(H4,8,9,13)(H3,10,11,14,15,16)/b12-2+ |
| InChIKey | MTVFCJSCATXGBX-SWGQDTFXSA-N |
| XLogP | -2.23 |
| TPSA | 162.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|