C7H9N3O3 — CID 137262645
5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-6-methyl-1H-pyrimidine-2,4-dione (PubChem CID 137262645) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-6-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-6-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137262645 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-6-methyl-1H-pyrimidine-2,4-dione |
| SMILES | C/C(=N\O)c1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H9N3O3/c1-3-5(4(2)10-13)6(11)9-7(12)8-3/h13H,1-2H3,(H2,8,9,11,12)/b10-4+ |
| InChIKey | COPQTADXRBHNQT-ONNFQVAWSA-N |
| XLogP | -0.43 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|