C5H5N4O2+ — CID 102482143
6-methyl-2,4-dioxo-1H-pyrimidine-5-diazonium (PubChem CID 102482143) has the molecular formula C5H5N4O2+ and a molecular weight of 153.12 g/mol. Its IUPAC name is 6-methyl-2,4-dioxo-1H-pyrimidine-5-diazonium.
| Compound Name | 6-methyl-2,4-dioxo-1H-pyrimidine-5-diazonium |
|---|---|
| PubChem CID | 102482143 |
| Molecular Formula | C5H5N4O2+ |
| Molecular Weight | 153.12 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 6-methyl-2,4-dioxo-1H-pyrimidine-5-diazonium |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1[N+]#N |
| InChI | InChI=1S/C5H4N4O2/c1-2-3(9-6)4(10)8-5(11)7-2/h1H3,(H-,7,8,10,11)/p+1 |
| InChIKey | IPSBIOFLUTUKLJ-UHFFFAOYSA-O |
| XLogP | -0.14 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.12 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|