C5H6N2O6S — CID 2189439
(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl) hydrogen sulfate (PubChem CID 2189439) has the molecular formula C5H6N2O6S and a molecular weight of 222.18 g/mol. Its IUPAC name is (6-methyl-2,4-dioxo-1H-pyrimidin-5-yl) hydrogen sulfate.
| Compound Name | (6-methyl-2,4-dioxo-1H-pyrimidin-5-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 2189439 |
| Molecular Formula | C5H6N2O6S |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | (6-methyl-2,4-dioxo-1H-pyrimidin-5-yl) hydrogen sulfate |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1OS(=O)(=O)O |
| InChI | InChI=1S/C5H6N2O6S/c1-2-3(13-14(10,11)12)4(8)7-5(9)6-2/h1H3,(H,10,11,12)(H2,6,7,8,9) |
| InChIKey | KNQPVVMPQFTQDD-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|