C21H22N4O2 — CID 172942191
5-[(Z)-N-(dibenzylamino)-C-methylcarbonimidoyl]-6-methyl-1H-pyrimidine-2,4-dione (PubChem CID 172942191) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 5-[(Z)-N-(dibenzylamino)-C-methylcarbonimidoyl]-6-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(Z)-N-(dibenzylamino)-C-methylcarbonimidoyl]-6-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172942191 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 5-[(Z)-N-(dibenzylamino)-C-methylcarbonimidoyl]-6-methyl-1H-pyrimidine-2,4-dione |
| SMILES | C/C(=N/N(Cc1ccccc1)Cc1ccccc1)c1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H22N4O2/c1-15-19(20(26)23-21(27)22-15)16(2)24-25(13-17-9-5-3-6-10-17)14-18-11-7-4-8-12-18/h3-12H,13-14H2,1-2H3,(H2,22,23,26,27)/b24-16- |
| InChIKey | HZJDMGPEFIQHFB-JLPGSUDCSA-N |
| XLogP | 2.80 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|