C19H23N3O3 — CID 47082599
3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-(2-phenylethyl)-N-prop-2-enylpropanamide (PubChem CID 47082599) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-(2-phenylethyl)-N-prop-2-enylpropanamide.
| Compound Name | 3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-(2-phenylethyl)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 47082599 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-(2-phenylethyl)-N-prop-2-enylpropanamide |
| SMILES | C=CCN(CCc1ccccc1)C(=O)CCc1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H23N3O3/c1-3-12-22(13-11-15-7-5-4-6-8-15)17(23)10-9-16-14(2)20-19(25)21-18(16)24/h3-8H,1,9-13H2,2H3,(H2,20,21,24,25) |
| InChIKey | OOBANOXATCRNKR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|