C48H50N6 — CID 89456137
N-benzyl-N-[(E)-[(3Z,4E)-3,4-bis(dibenzylhydrazinylidene)hexan-2-ylidene]amino]-1-phenylmethanamine (PubChem CID 89456137) has the molecular formula C48H50N6 and a molecular weight of 710.97 g/mol. Its IUPAC name is N-benzyl-N-[(E)-[(3Z,4E)-3,4-bis(dibenzylhydrazinylidene)hexan-2-ylidene]amino]-1-phenylmethanamine.
| Compound Name | N-benzyl-N-[(E)-[(3Z,4E)-3,4-bis(dibenzylhydrazinylidene)hexan-2-ylidene]amino]-1-phenylmethanamine |
|---|---|
| PubChem CID | 89456137 |
| Molecular Formula | C48H50N6 |
| Molecular Weight | 710.97 g/mol |
| Exact Mass | 710.41 |
| IUPAC Name | N-benzyl-N-[(E)-[(3Z,4E)-3,4-bis(dibenzylhydrazinylidene)hexan-2-ylidene]amino]-1-phenylmethanamine |
| SMILES | CCC(=N\N(Cc1ccccc1)Cc1ccccc1)/C(=N\N(Cc1ccccc1)Cc1ccccc1)C(/C)=N/N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C48H50N6/c1-3-47(50-53(36-43-26-14-6-15-27-43)37-44-28-16-7-17-29-44)48(51-54(38-45-30-18-8-19-31-45)39-46-32-20-9-21-33-46)40(2)49-52(34-41-22-10-4-11-23-41)35-42-24-12-5-13-25-42/h4-33H,3,34-39H2,1-2H3/b49-40+,50-47+,51-48- |
| InChIKey | CPJLGUTYAQYKIH-COTNYPOTSA-N |
| XLogP | 10.59 |
| TPSA | 46.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.97 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|