C24H38N4Si2 — CID 89456201
N-[(E)-[(3E)-3-[benzyl(trimethylsilyl)hydrazinylidene]butan-2-ylidene]amino]-1-phenyl-N-trimethylsilylmethanamine (PubChem CID 89456201) has the molecular formula C24H38N4Si2 and a molecular weight of 438.77 g/mol. Its IUPAC name is N-[(E)-[(3E)-3-[benzyl(trimethylsilyl)hydrazinylidene]butan-2-ylidene]amino]-1-phenyl-N-trimethylsilylmethanamine.
| Compound Name | N-[(E)-[(3E)-3-[benzyl(trimethylsilyl)hydrazinylidene]butan-2-ylidene]amino]-1-phenyl-N-trimethylsilylmethanamine |
|---|---|
| PubChem CID | 89456201 |
| Molecular Formula | C24H38N4Si2 |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-[(E)-[(3E)-3-[benzyl(trimethylsilyl)hydrazinylidene]butan-2-ylidene]amino]-1-phenyl-N-trimethylsilylmethanamine |
| SMILES | CC(=N\N(Cc1ccccc1)[Si](C)(C)C)/C(C)=N/N(Cc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C24H38N4Si2/c1-21(25-27(29(3,4)5)19-23-15-11-9-12-16-23)22(2)26-28(30(6,7)8)20-24-17-13-10-14-18-24/h9-18H,19-20H2,1-8H3/b25-21+,26-22+ |
| InChIKey | TXAOQUYIMBPDOP-CDTUYSNOSA-N |
| XLogP | 6.41 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|