About N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine
N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine (PubChem CID 23062047) has the molecular formula C12H21NOSi
and a molecular weight of 223.39 g/mol. Its IUPAC name is N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine.
Molecular Properties
| Compound Name | N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine |
| PubChem CID | 23062047 |
| Molecular Formula | C12H21NOSi |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine |
| SMILES | COCN(Cc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C12H21NOSi/c1-14-11-13(15(2,3)4)10-12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3 |
| InChIKey | RULHSLKSRFNQJO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine?
The IUPAC name of N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine (CID 23062047) is N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine.
What is the SMILES notation for N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine?
The canonical SMILES for N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine is COCN(Cc1ccccc1)[Si](C)(C)C.
What is the InChIKey of N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine?
The InChIKey is RULHSLKSRFNQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NOSi/c1-14-11-13(15(2,3)4)10-12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3.
What are the key properties of N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine?
N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine has a molecular weight of 223.39 g/mol, XLogP of 2.93, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(methoxymethyl)-1-phenyl-N-trimethylsilylmethanamine is sourced from PubChem (CID 23062047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).