C26H40N4Si2 — CID 89455964
N-[[3-[benzyl(trimethylsilyl)hydrazinylidene]cyclohexylidene]amino]-1-phenyl-N-trimethylsilylmethanamine (PubChem CID 89455964) has the molecular formula C26H40N4Si2 and a molecular weight of 464.81 g/mol. Its IUPAC name is N-[[3-[benzyl(trimethylsilyl)hydrazinylidene]cyclohexylidene]amino]-1-phenyl-N-trimethylsilylmethanamine.
| Compound Name | N-[[3-[benzyl(trimethylsilyl)hydrazinylidene]cyclohexylidene]amino]-1-phenyl-N-trimethylsilylmethanamine |
|---|---|
| PubChem CID | 89455964 |
| Molecular Formula | C26H40N4Si2 |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | N-[[3-[benzyl(trimethylsilyl)hydrazinylidene]cyclohexylidene]amino]-1-phenyl-N-trimethylsilylmethanamine |
| SMILES | C[Si](C)(C)N(Cc1ccccc1)N=C1CCCC(=NN(Cc2ccccc2)[Si](C)(C)C)C1 |
| InChI | InChI=1S/C26H40N4Si2/c1-31(2,3)29(21-23-14-9-7-10-15-23)27-25-18-13-19-26(20-25)28-30(32(4,5)6)22-24-16-11-8-12-17-24/h7-12,14-17H,13,18-22H2,1-6H3 |
| InChIKey | RFLZBNNBCIPNOR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|