C20H27NO — CID 19709160
cyclohexane;N,N-dibenzylhydroxylamine (PubChem CID 19709160) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is cyclohexane;N,N-dibenzylhydroxylamine.
| Compound Name | cyclohexane;N,N-dibenzylhydroxylamine |
|---|---|
| PubChem CID | 19709160 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | cyclohexane;N,N-dibenzylhydroxylamine |
| SMILES | C1CCCCC1.ON(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C14H15NO.C6H12/c16-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;1-2-4-6-5-3-1/h1-10,16H,11-12H2;1-6H2 |
| InChIKey | CEWSEGPAJOVJAZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|