C13H16O2S — CID 11831430
3,3-diethoxyprop-1-ynylsulfanylbenzene (PubChem CID 11831430) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is 3,3-diethoxyprop-1-ynylsulfanylbenzene.
| Compound Name | 3,3-diethoxyprop-1-ynylsulfanylbenzene |
|---|---|
| PubChem CID | 11831430 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 3,3-diethoxyprop-1-ynylsulfanylbenzene |
| SMILES | CCOC(C#CSc1ccccc1)OCC |
| InChI | InChI=1S/C13H16O2S/c1-3-14-13(15-4-2)10-11-16-12-8-6-5-7-9-12/h5-9,13H,3-4H2,1-2H3 |
| InChIKey | FKCKJNPMYNJYBT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|