C30H35F3O3 — CID 118316792
[4-[4-[(Z)-2-fluoroprop-1-enyl]cyclohexyl]phenyl] 4-(4-ethoxy-2,3-difluorophenyl)cyclohexane-1-carboxylate (PubChem CID 118316792) has the molecular formula C30H35F3O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is [4-[4-[(Z)-2-fluoroprop-1-enyl]cyclohexyl]phenyl] 4-(4-ethoxy-2,3-difluorophenyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[4-[(Z)-2-fluoroprop-1-enyl]cyclohexyl]phenyl] 4-(4-ethoxy-2,3-difluorophenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118316792 |
| Molecular Formula | C30H35F3O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | [4-[4-[(Z)-2-fluoroprop-1-enyl]cyclohexyl]phenyl] 4-(4-ethoxy-2,3-difluorophenyl)cyclohexane-1-carboxylate |
| SMILES | CCOc1ccc(C2CCC(C(=O)Oc3ccc(C4CCC(/C=C(/C)F)CC4)cc3)CC2)c(F)c1F |
| InChI | InChI=1S/C30H35F3O3/c1-3-35-27-17-16-26(28(32)29(27)33)23-8-10-24(11-9-23)30(34)36-25-14-12-22(13-15-25)21-6-4-20(5-7-21)18-19(2)31/h12-18,20-21,23-24H,3-11H2,1-2H3/b19-18- |
| InChIKey | JHRGMTDCIMUXBD-HNENSFHCSA-N |
| XLogP | 8.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|