C35H34F6N4O5 — CID 118316851
[(3S)-3-[[(2R,3S)-3-carbamoyl-6,6,6-trifluoro-2-(3,3,3-trifluoropropyl)hexanoyl]amino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]methyl 2-(4-methylphenyl)acetate (PubChem CID 118316851) has the molecular formula C35H34F6N4O5 and a molecular weight of 704.67 g/mol. Its IUPAC name is [(3S)-3-[[(2R,3S)-3-carbamoyl-6,6,6-trifluoro-2-(3,3,3-trifluoropropyl)hexanoyl]amino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]methyl 2-(4-methylphenyl)acetate.
| Compound Name | [(3S)-3-[[(2R,3S)-3-carbamoyl-6,6,6-trifluoro-2-(3,3,3-trifluoropropyl)hexanoyl]amino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]methyl 2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 118316851 |
| Molecular Formula | C35H34F6N4O5 |
| Molecular Weight | 704.67 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | [(3S)-3-[[(2R,3S)-3-carbamoyl-6,6,6-trifluoro-2-(3,3,3-trifluoropropyl)hexanoyl]amino]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]methyl 2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)OCN2C(=O)[C@@H](NC(=O)[C@H](CCC(F)(F)F)[C@H](CCC(F)(F)F)C(N)=O)N=C(c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C35H34F6N4O5/c1-21-11-13-22(14-12-21)19-28(46)50-20-45-27-10-6-5-9-26(27)29(23-7-3-2-4-8-23)43-31(33(45)49)44-32(48)25(16-18-35(39,40)41)24(30(42)47)15-17-34(36,37)38/h2-14,24-25,31H,15-20H2,1H3,(H2,42,47)(H,44,48)/t24-,25+,31+/m0/s1 |
| InChIKey | NEEJTZMYHKVIFX-NVDQFQLTSA-N |
| XLogP | 5.77 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |