C28H31F6N5O3S — CID 123548980
N-(2-aminoethylsulfanyl)-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2,3-bis(3,3,3-trifluoropropyl)butanediamide (PubChem CID 123548980) has the molecular formula C28H31F6N5O3S and a molecular weight of 631.64 g/mol. Its IUPAC name is N-(2-aminoethylsulfanyl)-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2,3-bis(3,3,3-trifluoropropyl)butanediamide.
| Compound Name | N-(2-aminoethylsulfanyl)-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2,3-bis(3,3,3-trifluoropropyl)butanediamide |
|---|---|
| PubChem CID | 123548980 |
| Molecular Formula | C28H31F6N5O3S |
| Molecular Weight | 631.64 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | N-(2-aminoethylsulfanyl)-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2,3-bis(3,3,3-trifluoropropyl)butanediamide |
| SMILES | CN1C(=O)C(NC(=O)C(CCC(F)(F)F)C(CCC(F)(F)F)C(=O)NSCCN)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H31F6N5O3S/c1-39-21-10-6-5-9-20(21)22(17-7-3-2-4-8-17)36-23(26(39)42)37-24(40)18(11-13-27(29,30)31)19(12-14-28(32,33)34)25(41)38-43-16-15-35/h2-10,18-19,23H,11-16,35H2,1H3,(H,37,40)(H,38,41) |
| InChIKey | KSTRAUWPWYGKRF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|