C31H37F6N5O3S — CID 144593051
(2S,3R)-N-[2-(dimethylamino)ethylsulfanyl]-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(4,4,4-trifluorobutyl)-2-(3,3,3-trifluoropropyl)butanediamide (PubChem CID 144593051) has the molecular formula C31H37F6N5O3S and a molecular weight of 673.72 g/mol. Its IUPAC name is (2S,3R)-N-[2-(dimethylamino)ethylsulfanyl]-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(4,4,4-trifluorobutyl)-2-(3,3,3-trifluoropropyl)butanediamide.
| Compound Name | (2S,3R)-N-[2-(dimethylamino)ethylsulfanyl]-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(4,4,4-trifluorobutyl)-2-(3,3,3-trifluoropropyl)butanediamide |
|---|---|
| PubChem CID | 144593051 |
| Molecular Formula | C31H37F6N5O3S |
| Molecular Weight | 673.72 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | (2S,3R)-N-[2-(dimethylamino)ethylsulfanyl]-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(4,4,4-trifluorobutyl)-2-(3,3,3-trifluoropropyl)butanediamide |
| SMILES | CN(C)CCSNC(=O)[C@@H](CCC(F)(F)F)[C@@H](CCCC(F)(F)F)C(=O)N[C@H]1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C31H37F6N5O3S/c1-41(2)18-19-46-40-28(44)22(15-17-31(35,36)37)21(13-9-16-30(32,33)34)27(43)39-26-29(45)42(3)24-14-8-7-12-23(24)25(38-26)20-10-5-4-6-11-20/h4-8,10-12,14,21-22,26H,9,13,15-19H2,1-3H3,(H,39,43)(H,40,44)/t21-,22+,26-/m1/s1 |
| InChIKey | VJAUOIPLBIQEEF-TVZXLZGTSA-N |
| XLogP | 5.58 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.72 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|