C32H37F6N5O4 — CID 90082903
(2S,3R)-N-[(4-hydroxypiperidin-1-yl)methyl]-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2,3-bis(3,3,3-trifluoropropyl)butanediamide (PubChem CID 90082903) has the molecular formula C32H37F6N5O4 and a molecular weight of 669.67 g/mol. Its IUPAC name is (2S,3R)-N-[(4-hydroxypiperidin-1-yl)methyl]-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2,3-bis(3,3,3-trifluoropropyl)butanediamide.
| Compound Name | (2S,3R)-N-[(4-hydroxypiperidin-1-yl)methyl]-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2,3-bis(3,3,3-trifluoropropyl)butanediamide |
|---|---|
| PubChem CID | 90082903 |
| Molecular Formula | C32H37F6N5O4 |
| Molecular Weight | 669.67 g/mol |
| Exact Mass | 669.27 |
| IUPAC Name | (2S,3R)-N-[(4-hydroxypiperidin-1-yl)methyl]-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2,3-bis(3,3,3-trifluoropropyl)butanediamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)C(CCC(F)(F)F)[C@H](CCC(F)(F)F)C(=O)NCN2CCC(O)CC2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C32H37F6N5O4/c1-42-25-10-6-5-9-24(25)26(20-7-3-2-4-8-20)40-27(30(42)47)41-29(46)23(12-16-32(36,37)38)22(11-15-31(33,34)35)28(45)39-19-43-17-13-21(44)14-18-43/h2-10,21-23,27,44H,11-19H2,1H3,(H,39,45)(H,41,46)/t22-,23?,27+/m0/s1 |
| InChIKey | DWKNHNBAPBFFRD-OKGSNBQPSA-N |
| XLogP | 4.39 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |