C28H34F3N5O3 — CID 144593030
(2R)-N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-N'-[(2-methylpropylamino)methyl]-2-(3,3,3-trifluoropropyl)butanediamide (PubChem CID 144593030) has the molecular formula C28H34F3N5O3 and a molecular weight of 545.61 g/mol. Its IUPAC name is (2R)-N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-N'-[(2-methylpropylamino)methyl]-2-(3,3,3-trifluoropropyl)butanediamide.
| Compound Name | (2R)-N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-N'-[(2-methylpropylamino)methyl]-2-(3,3,3-trifluoropropyl)butanediamide |
|---|---|
| PubChem CID | 144593030 |
| Molecular Formula | C28H34F3N5O3 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | (2R)-N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-N'-[(2-methylpropylamino)methyl]-2-(3,3,3-trifluoropropyl)butanediamide |
| SMILES | CC(C)CNCNC(=O)C[C@@H](CCC(F)(F)F)C(=O)N[C@H]1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C28H34F3N5O3/c1-18(2)16-32-17-33-23(37)15-20(13-14-28(29,30)31)26(38)35-25-27(39)36(3)22-12-8-7-11-21(22)24(34-25)19-9-5-4-6-10-19/h4-12,18,20,25,32H,13-17H2,1-3H3,(H,33,37)(H,35,38)/t20-,25-/m1/s1 |
| InChIKey | JJKKPRQQAZZXNK-CJFMBICVSA-N |
| XLogP | 3.61 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|