C34H41F6N5O5S — CID 123434868
tert-butyl N-[2-[[7,7,7-trifluoro-3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamoyl]-2-(3,3,3-trifluoropropyl)heptanoyl]amino]sulfanylethyl]carbamate (PubChem CID 123434868) has the molecular formula C34H41F6N5O5S and a molecular weight of 745.79 g/mol. Its IUPAC name is tert-butyl N-[2-[[7,7,7-trifluoro-3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamoyl]-2-(3,3,3-trifluoropropyl)heptanoyl]amino]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[7,7,7-trifluoro-3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamoyl]-2-(3,3,3-trifluoropropyl)heptanoyl]amino]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 123434868 |
| Molecular Formula | C34H41F6N5O5S |
| Molecular Weight | 745.79 g/mol |
| Exact Mass | 745.27 |
| IUPAC Name | tert-butyl N-[2-[[7,7,7-trifluoro-3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamoyl]-2-(3,3,3-trifluoropropyl)heptanoyl]amino]sulfanylethyl]carbamate |
| SMILES | CN1C(=O)C(NC(=O)C(CCCC(F)(F)F)C(CCC(F)(F)F)C(=O)NSCCNC(=O)OC(C)(C)C)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C34H41F6N5O5S/c1-32(2,3)50-31(49)41-19-20-51-44-29(47)23(16-18-34(38,39)40)22(14-10-17-33(35,36)37)28(46)43-27-30(48)45(4)25-15-9-8-13-24(25)26(42-27)21-11-6-5-7-12-21/h5-9,11-13,15,22-23,27H,10,14,16-20H2,1-4H3,(H,41,49)(H,43,46)(H,44,47) |
| InChIKey | RDIMLGIRRIIVKE-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.79 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|