C17H15NO — CID 11831815
(4R)-4-phenyl-2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 11831815) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is (4R)-4-phenyl-2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-phenyl-2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11831815 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (4R)-4-phenyl-2-[(E)-2-phenylethenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | C(=C/c1ccccc1)\C1=N[C@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C17H15NO/c1-3-7-14(8-4-1)11-12-17-18-16(13-19-17)15-9-5-2-6-10-15/h1-12,16H,13H2/b12-11+/t16-/m0/s1 |
| InChIKey | BMYYOANUEAIYJA-PCUGXKRQSA-N |
| XLogP | 3.87 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |