About 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane
3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane (PubChem CID 118321744) has the molecular formula C19H24O5
and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane.
Molecular Properties
| Compound Name | 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane |
| PubChem CID | 118321744 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane |
| SMILES | CC(=O)c1c(O)c2ccccc2oc1=O.CCCCCC1CCO1 |
| InChI | InChI=1S/C11H8O4.C8H16O/c1-6(12)9-10(13)7-4-2-3-5-8(7)15-11(9)14;1-2-3-4-5-8-6-7-9-8/h2-5,13H,1H3;8H,2-7H2,1H3 |
| InChIKey | DIHKSSJSCMOZRG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane?
The IUPAC name of 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane (CID 118321744) is 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane.
What is the SMILES notation for 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane?
The canonical SMILES for 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane is CC(=O)c1c(O)c2ccccc2oc1=O.CCCCCC1CCO1.
What is the InChIKey of 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane?
The InChIKey is DIHKSSJSCMOZRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O4.C8H16O/c1-6(12)9-10(13)7-4-2-3-5-8(7)15-11(9)14;1-2-3-4-5-8-6-7-9-8/h2-5,13H,1H3;8H,2-7H2,1H3.
What are the key properties of 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane?
3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane has a molecular weight of 332.40 g/mol, XLogP of 4.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-4-hydroxychromen-2-one;2-pentyloxetane is sourced from PubChem (CID 118321744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).