C25H29BrN2O3 — CID 118321757
5-bromo-3-decanoyl-2-oxo-N-phenyl-3H-indole-1-carboxamide (PubChem CID 118321757) has the molecular formula C25H29BrN2O3 and a molecular weight of 485.42 g/mol. Its IUPAC name is 5-bromo-3-decanoyl-2-oxo-N-phenyl-3H-indole-1-carboxamide.
| Compound Name | 5-bromo-3-decanoyl-2-oxo-N-phenyl-3H-indole-1-carboxamide |
|---|---|
| PubChem CID | 118321757 |
| Molecular Formula | C25H29BrN2O3 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 5-bromo-3-decanoyl-2-oxo-N-phenyl-3H-indole-1-carboxamide |
| SMILES | CCCCCCCCCC(=O)C1C(=O)N(C(=O)Nc2ccccc2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C25H29BrN2O3/c1-2-3-4-5-6-7-11-14-22(29)23-20-17-18(26)15-16-21(20)28(24(23)30)25(31)27-19-12-9-8-10-13-19/h8-10,12-13,15-17,23H,2-7,11,14H2,1H3,(H,27,31) |
| InChIKey | PVQSAQWSJUDNLN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|