C29H33NO2 — CID 118322615
(4-tert-butylphenyl)-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methanone (PubChem CID 118322615) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methanone.
| Compound Name | (4-tert-butylphenyl)-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118322615 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (4-tert-butylphenyl)-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H33NO2/c1-28(2,3)23-16-14-22(15-17-23)27(31)30-20-18-26(19-21-30)29(32,24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-17,26,32H,18-21H2,1-3H3 |
| InChIKey | SSRPEQQTTXNTQE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |