C24H26F3N3O2 — CID 118325422
N-(4-hydroxybutyl)-1-[3-[3-methyl-5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxamide (PubChem CID 118325422) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-1-[3-[3-methyl-5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxamide.
| Compound Name | N-(4-hydroxybutyl)-1-[3-[3-methyl-5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 118325422 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-(4-hydroxybutyl)-1-[3-[3-methyl-5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxamide |
| SMILES | Cc1cn(-c2cccc(N3CC(C(=O)NCCCCO)C3)c2)c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C24H26F3N3O2/c1-16-13-30(22-8-7-18(11-21(16)22)24(25,26)27)20-6-4-5-19(12-20)29-14-17(15-29)23(32)28-9-2-3-10-31/h4-8,11-13,17,31H,2-3,9-10,14-15H2,1H3,(H,28,32) |
| InChIKey | MMXXOIDRGWPROU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|