C21H19F3N2O4S — CID 118325024
1-[3-[3-ethylsulfonyl-5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylic acid (PubChem CID 118325024) has the molecular formula C21H19F3N2O4S and a molecular weight of 452.45 g/mol. Its IUPAC name is 1-[3-[3-ethylsulfonyl-5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3-[3-ethylsulfonyl-5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118325024 |
| Molecular Formula | C21H19F3N2O4S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-[3-[3-ethylsulfonyl-5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylic acid |
| SMILES | CCS(=O)(=O)c1cn(-c2cccc(N3CC(C(=O)O)C3)c2)c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C21H19F3N2O4S/c1-2-31(29,30)19-12-26(18-7-6-14(8-17(18)19)21(22,23)24)16-5-3-4-15(9-16)25-10-13(11-25)20(27)28/h3-9,12-13H,2,10-11H2,1H3,(H,27,28) |
| InChIKey | YPTRIKJBTHINNY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |