C20H17F3N2O2 — CID 118331444
1-[3-methyl-5-[5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylic acid (PubChem CID 118331444) has the molecular formula C20H17F3N2O2 and a molecular weight of 374.36 g/mol. Its IUPAC name is 1-[3-methyl-5-[5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3-methyl-5-[5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118331444 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-[3-methyl-5-[5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylic acid |
| SMILES | Cc1cc(N2CC(C(=O)O)C2)cc(-n2ccc3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C20H17F3N2O2/c1-12-6-16(24-10-14(11-24)19(26)27)9-17(7-12)25-5-4-13-8-15(20(21,22)23)2-3-18(13)25/h2-9,14H,10-11H2,1H3,(H,26,27) |
| InChIKey | DMDBJXPCVYUMJN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |