C21H19F3N2O2 — CID 126644914
methyl 1-[3-methyl-5-[5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylate (PubChem CID 126644914) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is methyl 1-[3-methyl-5-[5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[3-methyl-5-[5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 126644914 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | methyl 1-[3-methyl-5-[5-(trifluoromethyl)indol-1-yl]phenyl]azetidine-3-carboxylate |
| SMILES | COC(=O)C1CN(c2cc(C)cc(-n3ccc4cc(C(F)(F)F)ccc43)c2)C1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-13-7-17(25-11-15(12-25)20(27)28-2)10-18(8-13)26-6-5-14-9-16(21(22,23)24)3-4-19(14)26/h3-10,15H,11-12H2,1-2H3 |
| InChIKey | LJEYOMSJEMMPCK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |