About 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid
1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid (PubChem CID 118325366) has the molecular formula C25H33NO2
and a molecular weight of 379.54 g/mol. Its IUPAC name is 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid |
| PubChem CID | 118325366 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid |
| SMILES | Cc1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(N2CC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C25H33NO2/c1-16-8-17(12-22(9-16)26-14-19(15-26)23(27)28)18-10-20(24(2,3)4)13-21(11-18)25(5,6)7/h8-13,19H,14-15H2,1-7H3,(H,27,28) |
| InChIKey | BRYXUUZADMMEPX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid?
The IUPAC name of 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid (CID 118325366) is 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid.
What is the SMILES notation for 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid?
The canonical SMILES for 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid is Cc1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(N2CC(C(=O)O)C2)c1.
What is the InChIKey of 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid?
The InChIKey is BRYXUUZADMMEPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33NO2/c1-16-8-17(12-22(9-16)26-14-19(15-26)23(27)28)18-10-20(24(2,3)4)13-21(11-18)25(5,6)7/h8-13,19H,14-15H2,1-7H3,(H,27,28).
What are the key properties of 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid?
1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid has a molecular weight of 379.54 g/mol, XLogP of 5.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,5-ditert-butylphenyl)-5-methylphenyl]azetidine-3-carboxylic acid is sourced from PubChem (CID 118325366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).