C19H21NO3 — CID 126672521
1-[3-[3-(2-hydroxyethyl)phenyl]-5-methylphenyl]azetidine-3-carboxylic acid (PubChem CID 126672521) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 1-[3-[3-(2-hydroxyethyl)phenyl]-5-methylphenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3-[3-(2-hydroxyethyl)phenyl]-5-methylphenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 126672521 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-[3-[3-(2-hydroxyethyl)phenyl]-5-methylphenyl]azetidine-3-carboxylic acid |
| SMILES | Cc1cc(-c2cccc(CCO)c2)cc(N2CC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C19H21NO3/c1-13-7-16(15-4-2-3-14(9-15)5-6-21)10-18(8-13)20-11-17(12-20)19(22)23/h2-4,7-10,17,21H,5-6,11-12H2,1H3,(H,22,23) |
| InChIKey | RZACWUIFHRSEAX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |