C23H26F3NO3 — CID 118331356
1-[3-[2-(2-ethylbutoxy)-5-(trifluoromethyl)phenyl]phenyl]azetidine-3-carboxylic acid (PubChem CID 118331356) has the molecular formula C23H26F3NO3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 1-[3-[2-(2-ethylbutoxy)-5-(trifluoromethyl)phenyl]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3-[2-(2-ethylbutoxy)-5-(trifluoromethyl)phenyl]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118331356 |
| Molecular Formula | C23H26F3NO3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-[3-[2-(2-ethylbutoxy)-5-(trifluoromethyl)phenyl]phenyl]azetidine-3-carboxylic acid |
| SMILES | CCC(CC)COc1ccc(C(F)(F)F)cc1-c1cccc(N2CC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C23H26F3NO3/c1-3-15(4-2)14-30-21-9-8-18(23(24,25)26)11-20(21)16-6-5-7-19(10-16)27-12-17(13-27)22(28)29/h5-11,15,17H,3-4,12-14H2,1-2H3,(H,28,29) |
| InChIKey | TYVUEHZYUHERPU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |