C22H20F6N2O3 — CID 126645053
1-[3-[2,2-dimethyl-4,7-bis(trifluoromethyl)-3H-1,4-benzoxazin-5-yl]phenyl]azetidine-3-carboxylic acid (PubChem CID 126645053) has the molecular formula C22H20F6N2O3 and a molecular weight of 474.40 g/mol. Its IUPAC name is 1-[3-[2,2-dimethyl-4,7-bis(trifluoromethyl)-3H-1,4-benzoxazin-5-yl]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3-[2,2-dimethyl-4,7-bis(trifluoromethyl)-3H-1,4-benzoxazin-5-yl]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 126645053 |
| Molecular Formula | C22H20F6N2O3 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 1-[3-[2,2-dimethyl-4,7-bis(trifluoromethyl)-3H-1,4-benzoxazin-5-yl]phenyl]azetidine-3-carboxylic acid |
| SMILES | CC1(C)CN(C(F)(F)F)c2c(cc(C(F)(F)F)cc2-c2cccc(N3CC(C(=O)O)C3)c2)O1 |
| InChI | InChI=1S/C22H20F6N2O3/c1-20(2)11-30(22(26,27)28)18-16(7-14(21(23,24)25)8-17(18)33-20)12-4-3-5-15(6-12)29-9-13(10-29)19(31)32/h3-8,13H,9-11H2,1-2H3,(H,31,32) |
| InChIKey | VVRDJPXHAHCQRO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|