C23H21F3NO3- — CID 140776421
1-[3-[2-ethyl-2-methyl-7-(trifluoromethyl)chromen-4-yl]phenyl]azetidine-3-carboxylate (PubChem CID 140776421) has the molecular formula C23H21F3NO3- and a molecular weight of 416.42 g/mol. Its IUPAC name is 1-[3-[2-ethyl-2-methyl-7-(trifluoromethyl)chromen-4-yl]phenyl]azetidine-3-carboxylate.
| Compound Name | 1-[3-[2-ethyl-2-methyl-7-(trifluoromethyl)chromen-4-yl]phenyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 140776421 |
| Molecular Formula | C23H21F3NO3- |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-[3-[2-ethyl-2-methyl-7-(trifluoromethyl)chromen-4-yl]phenyl]azetidine-3-carboxylate |
| SMILES | CCC1(C)C=C(c2cccc(N3CC(C(=O)[O-])C3)c2)c2ccc(C(F)(F)F)cc2O1 |
| InChI | InChI=1S/C23H22F3NO3/c1-3-22(2)11-19(18-8-7-16(23(24,25)26)10-20(18)30-22)14-5-4-6-17(9-14)27-12-15(13-27)21(28)29/h4-11,15H,3,12-13H2,1-2H3,(H,28,29)/p-1 |
| InChIKey | PRVAISVYWATBMT-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |