C14H28N4O3 — CID 118327264
6-amino-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxobutan-2-yl]hexanamide (PubChem CID 118327264) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 6-amino-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxobutan-2-yl]hexanamide.
| Compound Name | 6-amino-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxobutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 118327264 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 6-amino-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxobutan-2-yl]hexanamide |
| SMILES | CCNC(=O)CNC(=O)[C@H](CC)NC(=O)CCCCCN |
| InChI | InChI=1S/C14H28N4O3/c1-3-11(14(21)17-10-13(20)16-4-2)18-12(19)8-6-5-7-9-15/h11H,3-10,15H2,1-2H3,(H,16,20)(H,17,21)(H,18,19)/t11-/m0/s1 |
| InChIKey | XDUBVOVXPPINHK-NSHDSACASA-N |
| XLogP | -0.35 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|