C9H20N4O2 — CID 89317284
2,5-diamino-N-[2-(ethylamino)-2-oxoethyl]pentanamide (PubChem CID 89317284) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2,5-diamino-N-[2-(ethylamino)-2-oxoethyl]pentanamide.
| Compound Name | 2,5-diamino-N-[2-(ethylamino)-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 89317284 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2,5-diamino-N-[2-(ethylamino)-2-oxoethyl]pentanamide |
| SMILES | CCNC(=O)CNC(=O)C(N)CCCN |
| InChI | InChI=1S/C9H20N4O2/c1-2-12-8(14)6-13-9(15)7(11)4-3-5-10/h7H,2-6,10-11H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | QMIYUBGIUKYPEM-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |