C19H21ClFNO3S — CID 118329322
3-(3-tert-butyl-2-fluorophenyl)-4-chloro-N-ethylsulfonylbenzamide (PubChem CID 118329322) has the molecular formula C19H21ClFNO3S and a molecular weight of 397.90 g/mol. Its IUPAC name is 3-(3-tert-butyl-2-fluorophenyl)-4-chloro-N-ethylsulfonylbenzamide.
| Compound Name | 3-(3-tert-butyl-2-fluorophenyl)-4-chloro-N-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 118329322 |
| Molecular Formula | C19H21ClFNO3S |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-(3-tert-butyl-2-fluorophenyl)-4-chloro-N-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)NC(=O)c1ccc(Cl)c(-c2cccc(C(C)(C)C)c2F)c1 |
| InChI | InChI=1S/C19H21ClFNO3S/c1-5-26(24,25)22-18(23)12-9-10-16(20)14(11-12)13-7-6-8-15(17(13)21)19(2,3)4/h6-11H,5H2,1-4H3,(H,22,23) |
| InChIKey | KRTLDAGKGTXPFZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |