About 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide
4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide (PubChem CID 118329340) has the molecular formula C13H17FO2S
and a molecular weight of 256.34 g/mol. Its IUPAC name is 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide.
Analyze 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The IUPAC name of 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide (CID 118329340) is 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide.
What is the SMILES notation for 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The canonical SMILES for 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide is CC(C)(C)C1CCS(=O)(=O)c2cc(F)ccc21.
What is the InChIKey of 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The InChIKey is VOKSWGIKYPUKRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FO2S/c1-13(2,3)11-6-7-17(15,16)12-8-9(14)4-5-10(11)12/h4-5,8,11H,6-7H2,1-3H3.
What are the key properties of 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide?
4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide has a molecular weight of 256.34 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-7-fluoro-3,4-dihydro-2H-thiochromene 1,1-dioxide is sourced from PubChem (CID 118329340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).