About 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine
6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43440318) has the molecular formula C15H22FNO2S
and a molecular weight of 299.41 g/mol. Its IUPAC name is 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine.
Molecular Properties
| Compound Name | 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| PubChem CID | 43440318 |
| Molecular Formula | C15H22FNO2S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CC(C)CC(C)NC1CCS(=O)(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C15H22FNO2S/c1-10(2)8-11(3)17-14-6-7-20(18,19)15-5-4-12(16)9-13(14)15/h4-5,9-11,14,17H,6-8H2,1-3H3 |
| InChIKey | AEUKHLPOCYYOOC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
The IUPAC name of 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (CID 43440318) is 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine.
What is the SMILES notation for 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
The canonical SMILES for 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine is CC(C)CC(C)NC1CCS(=O)(=O)c2ccc(F)cc21.
What is the InChIKey of 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
The InChIKey is AEUKHLPOCYYOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FNO2S/c1-10(2)8-11(3)17-14-6-7-20(18,19)15-5-4-12(16)9-13(14)15/h4-5,9-11,14,17H,6-8H2,1-3H3.
What are the key properties of 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine has a molecular weight of 299.41 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N-(4-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine is sourced from PubChem (CID 43440318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).