C15H22FNO3S — CID 82941544
6-fluoro-1,1-dioxo-N-(3-propoxypropyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 82941544) has the molecular formula C15H22FNO3S and a molecular weight of 315.41 g/mol. Its IUPAC name is 6-fluoro-1,1-dioxo-N-(3-propoxypropyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | 6-fluoro-1,1-dioxo-N-(3-propoxypropyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 82941544 |
| Molecular Formula | C15H22FNO3S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 6-fluoro-1,1-dioxo-N-(3-propoxypropyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCCOCCCNC1CCS(=O)(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C15H22FNO3S/c1-2-8-20-9-3-7-17-14-6-10-21(18,19)15-5-4-12(16)11-13(14)15/h4-5,11,14,17H,2-3,6-10H2,1H3 |
| InChIKey | BSYACXCKIPJQGW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|