C28H36N4O3 — CID 118329531
4-[4-[(1S,5R,6R)-8-(3-bicyclo[3.3.1]nonanyl)-8-azabicyclo[3.2.1]octan-6-yl]-3-oxoquinoxalin-2-yl]-4-iminobutanoic acid (PubChem CID 118329531) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 4-[4-[(1S,5R,6R)-8-(3-bicyclo[3.3.1]nonanyl)-8-azabicyclo[3.2.1]octan-6-yl]-3-oxoquinoxalin-2-yl]-4-iminobutanoic acid.
| Compound Name | 4-[4-[(1S,5R,6R)-8-(3-bicyclo[3.3.1]nonanyl)-8-azabicyclo[3.2.1]octan-6-yl]-3-oxoquinoxalin-2-yl]-4-iminobutanoic acid |
|---|---|
| PubChem CID | 118329531 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 4-[4-[(1S,5R,6R)-8-(3-bicyclo[3.3.1]nonanyl)-8-azabicyclo[3.2.1]octan-6-yl]-3-oxoquinoxalin-2-yl]-4-iminobutanoic acid |
| SMILES | [H]/N=C(\CCC(=O)O)c1nc2ccccc2n([C@@H]2C[C@@H]3CCC[C@H]2N3C2CC3CCCC(C3)C2)c1=O |
| InChI | InChI=1S/C28H36N4O3/c29-21(11-12-26(33)34)27-28(35)32(23-9-2-1-8-22(23)30-27)25-16-19-7-4-10-24(25)31(19)20-14-17-5-3-6-18(13-17)15-20/h1-2,8-9,17-20,24-25,29H,3-7,10-16H2,(H,33,34)/b29-21+/t17?,18?,19-,20?,24+,25+/m0/s1 |
| InChIKey | GPKBQIUBLYAOOY-MSPRPFGJSA-N |
| XLogP | 4.77 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|