C21H27ClN6O — CID 118329747
(3R,4R)-3-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-1-chloropiperidin-4-ol (PubChem CID 118329747) has the molecular formula C21H27ClN6O and a molecular weight of 414.94 g/mol. Its IUPAC name is (3R,4R)-3-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-1-chloropiperidin-4-ol.
| Compound Name | (3R,4R)-3-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-1-chloropiperidin-4-ol |
|---|---|
| PubChem CID | 118329747 |
| Molecular Formula | C21H27ClN6O |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (3R,4R)-3-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-1-chloropiperidin-4-ol |
| SMILES | CC(C)c1cnn2c(NCc3ccccc3)cc(N[C@@H]3CN(Cl)CC[C@H]3O)nc12 |
| InChI | InChI=1S/C21H27ClN6O/c1-14(2)16-12-24-28-20(23-11-15-6-4-3-5-7-15)10-19(26-21(16)28)25-17-13-27(22)9-8-18(17)29/h3-7,10,12,14,17-18,23,29H,8-9,11,13H2,1-2H3,(H,25,26)/t17-,18-/m1/s1 |
| InChIKey | ANWIJSNXGJBYKO-QZTJIDSGSA-N |
| XLogP | 3.47 |
| TPSA | 77.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|