C20H25N5O — CID 25124679
(2R)-2-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]but-3-en-1-ol (PubChem CID 25124679) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is (2R)-2-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]but-3-en-1-ol.
| Compound Name | (2R)-2-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]but-3-en-1-ol |
|---|---|
| PubChem CID | 25124679 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (2R)-2-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]but-3-en-1-ol |
| SMILES | C=C[C@H](CO)Nc1cc(NCc2ccccc2)n2ncc(C(C)C)c2n1 |
| InChI | InChI=1S/C20H25N5O/c1-4-16(13-26)23-18-10-19(21-11-15-8-6-5-7-9-15)25-20(24-18)17(12-22-25)14(2)3/h4-10,12,14,16,21,26H,1,11,13H2,2-3H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | IHZOGMSQAVEZJI-MRXNPFEDSA-N |
| XLogP | 3.42 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|