C14H16BrN7O — CID 70806600
(2R)-2-amino-2-[[3-bromo-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino]ethanol (PubChem CID 70806600) has the molecular formula C14H16BrN7O and a molecular weight of 378.23 g/mol. Its IUPAC name is (2R)-2-amino-2-[[3-bromo-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino]ethanol.
| Compound Name | (2R)-2-amino-2-[[3-bromo-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino]ethanol |
|---|---|
| PubChem CID | 70806600 |
| Molecular Formula | C14H16BrN7O |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | (2R)-2-amino-2-[[3-bromo-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino]ethanol |
| SMILES | N[C@@H](CO)Nc1cc(NCc2cccnc2)n2ncc(Br)c2n1 |
| InChI | InChI=1S/C14H16BrN7O/c15-10-7-19-22-13(18-6-9-2-1-3-17-5-9)4-12(21-14(10)22)20-11(16)8-23/h1-5,7,11,18,23H,6,8,16H2,(H,20,21)/t11-/m1/s1 |
| InChIKey | BEKGJTCQCSHTMR-LLVKDONJSA-N |
| XLogP | 1.19 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|