C19H16BrN6O+ — CID 58828967
1-[4-[3-bromo-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]pyridin-1-ium-1-yl]ethanone (PubChem CID 58828967) has the molecular formula C19H16BrN6O+ and a molecular weight of 424.28 g/mol. Its IUPAC name is 1-[4-[3-bromo-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]pyridin-1-ium-1-yl]ethanone.
| Compound Name | 1-[4-[3-bromo-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]pyridin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 58828967 |
| Molecular Formula | C19H16BrN6O+ |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 1-[4-[3-bromo-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]pyridin-1-ium-1-yl]ethanone |
| SMILES | CC(=O)[n+]1ccc(-c2cc(NCc3cccnc3)n3ncc(Br)c3n2)cc1 |
| InChI | InChI=1S/C19H16BrN6O/c1-13(27)25-7-4-15(5-8-25)17-9-18(22-11-14-3-2-6-21-10-14)26-19(24-17)16(20)12-23-26/h2-10,12,22H,11H2,1H3/q+1 |
| InChIKey | GNDKUKBEUZWOCK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|