C27H28ClFN3O6P — CID 118330247
[1-[2-[(3S,3aS,6aR)-3-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-oxoethyl]-3-acetylindol-6-yl]phosphonic acid (PubChem CID 118330247) has the molecular formula C27H28ClFN3O6P and a molecular weight of 575.96 g/mol. Its IUPAC name is [1-[2-[(3S,3aS,6aR)-3-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-oxoethyl]-3-acetylindol-6-yl]phosphonic acid.
| Compound Name | [1-[2-[(3S,3aS,6aR)-3-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-oxoethyl]-3-acetylindol-6-yl]phosphonic acid |
|---|---|
| PubChem CID | 118330247 |
| Molecular Formula | C27H28ClFN3O6P |
| Molecular Weight | 575.96 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | [1-[2-[(3S,3aS,6aR)-3-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-oxoethyl]-3-acetylindol-6-yl]phosphonic acid |
| SMILES | CC(=O)c1cn(CC(=O)N2C[C@@H]3CCC[C@@H]3[C@H]2C(=O)NCc2cccc(Cl)c2F)c2cc(P(=O)(O)O)ccc12 |
| InChI | InChI=1S/C27H28ClFN3O6P/c1-15(33)21-13-31(23-10-18(39(36,37)38)8-9-20(21)23)14-24(34)32-12-17-5-2-6-19(17)26(32)27(35)30-11-16-4-3-7-22(28)25(16)29/h3-4,7-10,13,17,19,26H,2,5-6,11-12,14H2,1H3,(H,30,35)(H2,36,37,38)/t17-,19-,26-/m0/s1 |
| InChIKey | LQEKFFTXFBFBHM-IAKTWSEQSA-N |
| XLogP | 3.38 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.96 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|