C27H24N6 — CID 118331748
1-[4-(4,6-diphenyl-1,3,5-triazinan-2-yl)phenyl]benzotriazole (PubChem CID 118331748) has the molecular formula C27H24N6 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-[4-(4,6-diphenyl-1,3,5-triazinan-2-yl)phenyl]benzotriazole.
| Compound Name | 1-[4-(4,6-diphenyl-1,3,5-triazinan-2-yl)phenyl]benzotriazole |
|---|---|
| PubChem CID | 118331748 |
| Molecular Formula | C27H24N6 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-[4-(4,6-diphenyl-1,3,5-triazinan-2-yl)phenyl]benzotriazole |
| SMILES | c1ccc(C2NC(c3ccccc3)NC(c3ccc(-n4nnc5ccccc54)cc3)N2)cc1 |
| InChI | InChI=1S/C27H24N6/c1-3-9-19(10-4-1)25-28-26(20-11-5-2-6-12-20)30-27(29-25)21-15-17-22(18-16-21)33-24-14-8-7-13-23(24)31-32-33/h1-18,25-30H |
| InChIKey | NVOIHKFQRKXHNC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |