C27H23IN6 — CID 118331810
1-[3-(1-iodo-4,6-diphenyl-1,3,5-triazinan-2-yl)phenyl]benzotriazole (PubChem CID 118331810) has the molecular formula C27H23IN6 and a molecular weight of 558.43 g/mol. Its IUPAC name is 1-[3-(1-iodo-4,6-diphenyl-1,3,5-triazinan-2-yl)phenyl]benzotriazole.
| Compound Name | 1-[3-(1-iodo-4,6-diphenyl-1,3,5-triazinan-2-yl)phenyl]benzotriazole |
|---|---|
| PubChem CID | 118331810 |
| Molecular Formula | C27H23IN6 |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | 1-[3-(1-iodo-4,6-diphenyl-1,3,5-triazinan-2-yl)phenyl]benzotriazole |
| SMILES | IN1C(c2ccccc2)NC(c2ccccc2)NC1c1cccc(-n2nnc3ccccc32)c1 |
| InChI | InChI=1S/C27H23IN6/c28-33-26(20-12-5-2-6-13-20)29-25(19-10-3-1-4-11-19)30-27(33)21-14-9-15-22(18-21)34-24-17-8-7-16-23(24)31-32-34/h1-18,25-27,29-30H |
| InChIKey | IDUQWICGAXZDQL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|